C16H21Cl3N4O3S — CID 119830565
4-amino-5-chloro-2-methoxy-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]benzamide;dihydrochloride (PubChem CID 119830565) has the molecular formula C16H21Cl3N4O3S and a molecular weight of 455.80 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]benzamide;dihydrochloride.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119830565 |
| Molecular Formula | C16H21Cl3N4O3S |
| Molecular Weight | 455.80 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]benzamide;dihydrochloride |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)Nc1nc(CN2CCOCC2)cs1.Cl.Cl |
| InChI | InChI=1S/C16H19ClN4O3S.2ClH/c1-23-14-7-13(18)12(17)6-11(14)15(22)20-16-19-10(9-25-16)8-21-2-4-24-5-3-21;;/h6-7,9H,2-5,8,18H2,1H3,(H,19,20,22);2*1H |
| InChIKey | BXGYDMKTKHRAAG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.80 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|