C15H17Cl2N3O4S — CID 119672760
ethyl 2-[2-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-1,3-thiazol-4-yl]acetate;hydrochloride (PubChem CID 119672760) has the molecular formula C15H17Cl2N3O4S and a molecular weight of 406.29 g/mol. Its IUPAC name is ethyl 2-[2-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-1,3-thiazol-4-yl]acetate;hydrochloride.
| Compound Name | ethyl 2-[2-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-1,3-thiazol-4-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 119672760 |
| Molecular Formula | C15H17Cl2N3O4S |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | ethyl 2-[2-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-1,3-thiazol-4-yl]acetate;hydrochloride |
| SMILES | CCOC(=O)Cc1csc(NC(=O)c2cc(Cl)c(N)cc2OC)n1.Cl |
| InChI | InChI=1S/C15H16ClN3O4S.ClH/c1-3-23-13(20)4-8-7-24-15(18-8)19-14(21)9-5-10(16)11(17)6-12(9)22-2;/h5-7H,3-4,17H2,1-2H3,(H,18,19,21);1H |
| InChIKey | RNOQFOUKPHZPSI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|