C14H12ClIN2O3S — CID 38937088
ethyl 2-[2-[(4-chloro-3-iodobenzoyl)amino]-1,3-thiazol-4-yl]acetate (PubChem CID 38937088) has the molecular formula C14H12ClIN2O3S and a molecular weight of 450.69 g/mol. Its IUPAC name is ethyl 2-[2-[(4-chloro-3-iodobenzoyl)amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(4-chloro-3-iodobenzoyl)amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 38937088 |
| Molecular Formula | C14H12ClIN2O3S |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 449.93 |
| IUPAC Name | ethyl 2-[2-[(4-chloro-3-iodobenzoyl)amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)c2ccc(Cl)c(I)c2)n1 |
| InChI | InChI=1S/C14H12ClIN2O3S/c1-2-21-12(19)6-9-7-22-14(17-9)18-13(20)8-3-4-10(15)11(16)5-8/h3-5,7H,2,6H2,1H3,(H,17,18,20) |
| InChIKey | DZESZROHXDPGKK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|