C19H21ClN4O6S — CID 16962082
ethyl 2-[2-[[2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 16962082) has the molecular formula C19H21ClN4O6S and a molecular weight of 468.92 g/mol. Its IUPAC name is ethyl 2-[2-[[2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[[2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 16962082 |
| Molecular Formula | C19H21ClN4O6S |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | ethyl 2-[2-[[2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)C(NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)C(C)C)n1 |
| InChI | InChI=1S/C19H21ClN4O6S/c1-4-30-15(25)8-12-9-31-19(21-12)23-18(27)16(10(2)3)22-17(26)11-5-6-13(20)14(7-11)24(28)29/h5-7,9-10,16H,4,8H2,1-3H3,(H,22,26)(H,21,23,27) |
| InChIKey | NIOVPFYQRZCDIT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|