C20H18N4O5S — CID 17481677
ethyl 2-[2-[(4-anilino-3-nitrobenzoyl)amino]-1,3-thiazol-4-yl]acetate (PubChem CID 17481677) has the molecular formula C20H18N4O5S and a molecular weight of 426.45 g/mol. Its IUPAC name is ethyl 2-[2-[(4-anilino-3-nitrobenzoyl)amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(4-anilino-3-nitrobenzoyl)amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 17481677 |
| Molecular Formula | C20H18N4O5S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | ethyl 2-[2-[(4-anilino-3-nitrobenzoyl)amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)c2ccc(Nc3ccccc3)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C20H18N4O5S/c1-2-29-18(25)11-15-12-30-20(22-15)23-19(26)13-8-9-16(17(10-13)24(27)28)21-14-6-4-3-5-7-14/h3-10,12,21H,2,11H2,1H3,(H,22,23,26) |
| InChIKey | KTQSEYHLNSZGFJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|