C16H16N4O5S — CID 38986923
methyl 2-[2-[[4-(cyclopropylamino)-3-nitrobenzoyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 38986923) has the molecular formula C16H16N4O5S and a molecular weight of 376.39 g/mol. Its IUPAC name is methyl 2-[2-[[4-(cyclopropylamino)-3-nitrobenzoyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-[[4-(cyclopropylamino)-3-nitrobenzoyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 38986923 |
| Molecular Formula | C16H16N4O5S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | methyl 2-[2-[[4-(cyclopropylamino)-3-nitrobenzoyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1csc(NC(=O)c2ccc(NC3CC3)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C16H16N4O5S/c1-25-14(21)7-11-8-26-16(18-11)19-15(22)9-2-5-12(17-10-3-4-10)13(6-9)20(23)24/h2,5-6,8,10,17H,3-4,7H2,1H3,(H,18,19,22) |
| InChIKey | HDXYDWFTNBLDTQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|