C16H15F3N4O5S — CID 55656104
methyl 2-[2-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 55656104) has the molecular formula C16H15F3N4O5S and a molecular weight of 432.38 g/mol. Its IUPAC name is methyl 2-[2-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 55656104 |
| Molecular Formula | C16H15F3N4O5S |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | methyl 2-[2-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1csc(NC(=O)CCNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C16H15F3N4O5S/c1-28-14(25)7-10-8-29-15(21-10)22-13(24)4-5-20-11-3-2-9(16(17,18)19)6-12(11)23(26)27/h2-3,6,8,20H,4-5,7H2,1H3,(H,21,22,24) |
| InChIKey | CFYHCZPQZPVKIQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|