C14H18F3N3O4 — CID 51265088
N-(1-methoxypropan-2-yl)-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide (PubChem CID 51265088) has the molecular formula C14H18F3N3O4 and a molecular weight of 349.31 g/mol. Its IUPAC name is N-(1-methoxypropan-2-yl)-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-(1-methoxypropan-2-yl)-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 51265088 |
| Molecular Formula | C14H18F3N3O4 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-(1-methoxypropan-2-yl)-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
| SMILES | COCC(C)NC(=O)CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18F3N3O4/c1-9(8-24-2)19-13(21)5-6-18-11-4-3-10(14(15,16)17)7-12(11)20(22)23/h3-4,7,9,18H,5-6,8H2,1-2H3,(H,19,21) |
| InChIKey | LXXNPWFGLIFXHN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|