C19H17F5N4O4 — CID 55502080
N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide (PubChem CID 55502080) has the molecular formula C19H17F5N4O4 and a molecular weight of 460.36 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 55502080 |
| Molecular Formula | C19H17F5N4O4 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
| SMILES | CNC(=O)C(NC(=O)CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H17F5N4O4/c1-25-18(30)17(10-2-4-12(20)13(21)8-10)27-16(29)6-7-26-14-5-3-11(19(22,23)24)9-15(14)28(31)32/h2-5,8-9,17,26H,6-7H2,1H3,(H,25,30)(H,27,29) |
| InChIKey | KFVXUHUNOFOBIU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|