C16H18F3N3O7 — CID 56580563
methyl 2-[(2-methoxy-2-oxoethyl)-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]amino]acetate (PubChem CID 56580563) has the molecular formula C16H18F3N3O7 and a molecular weight of 421.33 g/mol. Its IUPAC name is methyl 2-[(2-methoxy-2-oxoethyl)-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]amino]acetate.
| Compound Name | methyl 2-[(2-methoxy-2-oxoethyl)-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]amino]acetate |
|---|---|
| PubChem CID | 56580563 |
| Molecular Formula | C16H18F3N3O7 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | methyl 2-[(2-methoxy-2-oxoethyl)-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]amino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)C(=O)CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18F3N3O7/c1-28-14(24)8-21(9-15(25)29-2)13(23)5-6-20-11-4-3-10(16(17,18)19)7-12(11)22(26)27/h3-4,7,20H,5-6,8-9H2,1-2H3 |
| InChIKey | RINSFWKSVQNNRH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|