C15H16F3N3O5 — CID 119194560
2-[cyclopropyl-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]amino]acetic acid (PubChem CID 119194560) has the molecular formula C15H16F3N3O5 and a molecular weight of 375.30 g/mol. Its IUPAC name is 2-[cyclopropyl-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]amino]acetic acid.
| Compound Name | 2-[cyclopropyl-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 119194560 |
| Molecular Formula | C15H16F3N3O5 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-[cyclopropyl-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]amino]acetic acid |
| SMILES | O=C(O)CN(C(=O)CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])C1CC1 |
| InChI | InChI=1S/C15H16F3N3O5/c16-15(17,18)9-1-4-11(12(7-9)21(25)26)19-6-5-13(22)20(8-14(23)24)10-2-3-10/h1,4,7,10,19H,2-3,5-6,8H2,(H,23,24) |
| InChIKey | MDHZARSERALFME-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|