C16H23F3N4O3 — CID 119654510
N-(3-amino-2,2-dimethylpropyl)-N-methyl-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide (PubChem CID 119654510) has the molecular formula C16H23F3N4O3 and a molecular weight of 376.38 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-N-methyl-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-N-methyl-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 119654510 |
| Molecular Formula | C16H23F3N4O3 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-N-methyl-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
| SMILES | CN(CC(C)(C)CN)C(=O)CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H23F3N4O3/c1-15(2,9-20)10-22(3)14(24)6-7-21-12-5-4-11(16(17,18)19)8-13(12)23(25)26/h4-5,8,21H,6-7,9-10,20H2,1-3H3 |
| InChIKey | MHTXZPGONSCXLD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|