C19H18F4N4O4 — CID 56566243
N-[2-amino-1-(3-fluorophenyl)-2-oxoethyl]-N-methyl-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide (PubChem CID 56566243) has the molecular formula C19H18F4N4O4 and a molecular weight of 442.37 g/mol. Its IUPAC name is N-[2-amino-1-(3-fluorophenyl)-2-oxoethyl]-N-methyl-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-[2-amino-1-(3-fluorophenyl)-2-oxoethyl]-N-methyl-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 56566243 |
| Molecular Formula | C19H18F4N4O4 |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-[2-amino-1-(3-fluorophenyl)-2-oxoethyl]-N-methyl-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
| SMILES | CN(C(=O)CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])C(C(N)=O)c1cccc(F)c1 |
| InChI | InChI=1S/C19H18F4N4O4/c1-26(17(18(24)29)11-3-2-4-13(20)9-11)16(28)7-8-25-14-6-5-12(19(21,22)23)10-15(14)27(30)31/h2-6,9-10,17,25H,7-8H2,1H3,(H2,24,29) |
| InChIKey | PBOSDNBPWJYXAE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|