C17H18F3N5O5 — CID 46477655
N-methyl-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide (PubChem CID 46477655) has the molecular formula C17H18F3N5O5 and a molecular weight of 429.36 g/mol. Its IUPAC name is N-methyl-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-methyl-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 46477655 |
| Molecular Formula | C17H18F3N5O5 |
| Molecular Weight | 429.36 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | N-methyl-N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
| SMILES | Cc1cc(NC(=O)CN(C)C(=O)CCNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])no1 |
| InChI | InChI=1S/C17H18F3N5O5/c1-10-7-14(23-30-10)22-15(26)9-24(2)16(27)5-6-21-12-4-3-11(17(18,19)20)8-13(12)25(28)29/h3-4,7-8,21H,5-6,9H2,1-2H3,(H,22,23,26) |
| InChIKey | KEFIZTZRCIBYJM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|