C15H26ClN5O5S — CID 119656680
N-(3-amino-2,2-dimethylpropyl)-N-methyl-3-(2-nitro-4-sulfamoylanilino)propanamide;hydrochloride (PubChem CID 119656680) has the molecular formula C15H26ClN5O5S and a molecular weight of 423.92 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-N-methyl-3-(2-nitro-4-sulfamoylanilino)propanamide;hydrochloride.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-N-methyl-3-(2-nitro-4-sulfamoylanilino)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119656680 |
| Molecular Formula | C15H26ClN5O5S |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-N-methyl-3-(2-nitro-4-sulfamoylanilino)propanamide;hydrochloride |
| SMILES | CN(CC(C)(C)CN)C(=O)CCNc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C15H25N5O5S.ClH/c1-15(2,9-16)10-19(3)14(21)6-7-18-12-5-4-11(26(17,24)25)8-13(12)20(22)23;/h4-5,8,18H,6-7,9-10,16H2,1-3H3,(H2,17,24,25);1H |
| InChIKey | LPAHPDMOLQMIRB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 161.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|