C18H21FN4O6S — CID 55431330
N-[2-(2-fluorophenoxy)ethyl]-N-methyl-3-(2-nitro-4-sulfamoylanilino)propanamide (PubChem CID 55431330) has the molecular formula C18H21FN4O6S and a molecular weight of 440.45 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)ethyl]-N-methyl-3-(2-nitro-4-sulfamoylanilino)propanamide.
| Compound Name | N-[2-(2-fluorophenoxy)ethyl]-N-methyl-3-(2-nitro-4-sulfamoylanilino)propanamide |
|---|---|
| PubChem CID | 55431330 |
| Molecular Formula | C18H21FN4O6S |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | N-[2-(2-fluorophenoxy)ethyl]-N-methyl-3-(2-nitro-4-sulfamoylanilino)propanamide |
| SMILES | CN(CCOc1ccccc1F)C(=O)CCNc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21FN4O6S/c1-22(10-11-29-17-5-3-2-4-14(17)19)18(24)8-9-21-15-7-6-13(30(20,27)28)12-16(15)23(25)26/h2-7,12,21H,8-11H2,1H3,(H2,20,27,28) |
| InChIKey | WXHYOKYDJJRRCS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|