C16H17FN2O5S — CID 55903608
N-[2-(2-fluorophenoxy)ethyl]-N,2-dimethyl-6-nitrobenzenesulfonamide (PubChem CID 55903608) has the molecular formula C16H17FN2O5S and a molecular weight of 368.39 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)ethyl]-N,2-dimethyl-6-nitrobenzenesulfonamide.
| Compound Name | N-[2-(2-fluorophenoxy)ethyl]-N,2-dimethyl-6-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55903608 |
| Molecular Formula | C16H17FN2O5S |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | N-[2-(2-fluorophenoxy)ethyl]-N,2-dimethyl-6-nitrobenzenesulfonamide |
| SMILES | Cc1cccc([N+](=O)[O-])c1S(=O)(=O)N(C)CCOc1ccccc1F |
| InChI | InChI=1S/C16H17FN2O5S/c1-12-6-5-8-14(19(20)21)16(12)25(22,23)18(2)10-11-24-15-9-4-3-7-13(15)17/h3-9H,10-11H2,1-2H3 |
| InChIKey | LFKIQKBOPOPKPB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|