C17H17ClFNO4S — CID 18124124
2-(4-chlorophenyl)sulfonyl-N-[2-(2-fluorophenoxy)ethyl]-N-methylacetamide (PubChem CID 18124124) has the molecular formula C17H17ClFNO4S and a molecular weight of 385.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-N-[2-(2-fluorophenoxy)ethyl]-N-methylacetamide.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-N-[2-(2-fluorophenoxy)ethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 18124124 |
| Molecular Formula | C17H17ClFNO4S |
| Molecular Weight | 385.84 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-N-[2-(2-fluorophenoxy)ethyl]-N-methylacetamide |
| SMILES | CN(CCOc1ccccc1F)C(=O)CS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClFNO4S/c1-20(10-11-24-16-5-3-2-4-15(16)19)17(21)12-25(22,23)14-8-6-13(18)7-9-14/h2-9H,10-12H2,1H3 |
| InChIKey | SCJFCRDHDJQNSY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.84 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |