C14H22ClFN2O3 — CID 120587497
4-amino-N-[2-(2-fluorophenoxy)ethyl]-3-methoxy-N-methylbutanamide;hydrochloride (PubChem CID 120587497) has the molecular formula C14H22ClFN2O3 and a molecular weight of 320.79 g/mol. Its IUPAC name is 4-amino-N-[2-(2-fluorophenoxy)ethyl]-3-methoxy-N-methylbutanamide;hydrochloride.
| Compound Name | 4-amino-N-[2-(2-fluorophenoxy)ethyl]-3-methoxy-N-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 120587497 |
| Molecular Formula | C14H22ClFN2O3 |
| Molecular Weight | 320.79 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 4-amino-N-[2-(2-fluorophenoxy)ethyl]-3-methoxy-N-methylbutanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)N(C)CCOc1ccccc1F.Cl |
| InChI | InChI=1S/C14H21FN2O3.ClH/c1-17(14(18)9-11(10-16)19-2)7-8-20-13-6-4-3-5-12(13)15;/h3-6,11H,7-10,16H2,1-2H3;1H |
| InChIKey | PVXWHJUOAZPUTR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.79 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |