C15H27Cl2N3O2 — CID 120596713
4-amino-3-methoxy-N-methyl-N-[2-(N-methylanilino)ethyl]butanamide;dihydrochloride (PubChem CID 120596713) has the molecular formula C15H27Cl2N3O2 and a molecular weight of 352.31 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-methyl-N-[2-(N-methylanilino)ethyl]butanamide;dihydrochloride.
| Compound Name | 4-amino-3-methoxy-N-methyl-N-[2-(N-methylanilino)ethyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 120596713 |
| Molecular Formula | C15H27Cl2N3O2 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 4-amino-3-methoxy-N-methyl-N-[2-(N-methylanilino)ethyl]butanamide;dihydrochloride |
| SMILES | COC(CN)CC(=O)N(C)CCN(C)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C15H25N3O2.2ClH/c1-17(13-7-5-4-6-8-13)9-10-18(2)15(19)11-14(12-16)20-3;;/h4-8,14H,9-12,16H2,1-3H3;2*1H |
| InChIKey | OOCNHAXZWVRNPB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |