C14H25Cl2N3O2 — CID 120594933
4-amino-3-methoxy-N-[2-(N-methylanilino)ethyl]butanamide;dihydrochloride (PubChem CID 120594933) has the molecular formula C14H25Cl2N3O2 and a molecular weight of 338.28 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[2-(N-methylanilino)ethyl]butanamide;dihydrochloride.
| Compound Name | 4-amino-3-methoxy-N-[2-(N-methylanilino)ethyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 120594933 |
| Molecular Formula | C14H25Cl2N3O2 |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 4-amino-3-methoxy-N-[2-(N-methylanilino)ethyl]butanamide;dihydrochloride |
| SMILES | COC(CN)CC(=O)NCCN(C)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C14H23N3O2.2ClH/c1-17(12-6-4-3-5-7-12)9-8-16-14(18)10-13(11-15)19-2;;/h3-7,13H,8-11,15H2,1-2H3,(H,16,18);2*1H |
| InChIKey | LFQUMMKTPAMNQE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |