C14H23ClN2O4S — CID 120590590
4-amino-N-[3-(benzenesulfonyl)propyl]-3-methoxybutanamide;hydrochloride (PubChem CID 120590590) has the molecular formula C14H23ClN2O4S and a molecular weight of 350.87 g/mol. Its IUPAC name is 4-amino-N-[3-(benzenesulfonyl)propyl]-3-methoxybutanamide;hydrochloride.
| Compound Name | 4-amino-N-[3-(benzenesulfonyl)propyl]-3-methoxybutanamide;hydrochloride |
|---|---|
| PubChem CID | 120590590 |
| Molecular Formula | C14H23ClN2O4S |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 4-amino-N-[3-(benzenesulfonyl)propyl]-3-methoxybutanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)NCCCS(=O)(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C14H22N2O4S.ClH/c1-20-12(11-15)10-14(17)16-8-5-9-21(18,19)13-6-3-2-4-7-13;/h2-4,6-7,12H,5,8-11,15H2,1H3,(H,16,17);1H |
| InChIKey | DEGLMHCNAKKEBM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|