C15H25ClN2O3 — CID 120587503
4-amino-3-methoxy-N-methyl-N-[2-(3-methylphenoxy)ethyl]butanamide;hydrochloride (PubChem CID 120587503) has the molecular formula C15H25ClN2O3 and a molecular weight of 316.83 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-methyl-N-[2-(3-methylphenoxy)ethyl]butanamide;hydrochloride.
| Compound Name | 4-amino-3-methoxy-N-methyl-N-[2-(3-methylphenoxy)ethyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 120587503 |
| Molecular Formula | C15H25ClN2O3 |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 4-amino-3-methoxy-N-methyl-N-[2-(3-methylphenoxy)ethyl]butanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)N(C)CCOc1cccc(C)c1.Cl |
| InChI | InChI=1S/C15H24N2O3.ClH/c1-12-5-4-6-13(9-12)20-8-7-17(2)15(18)10-14(11-16)19-3;/h4-6,9,14H,7-8,10-11,16H2,1-3H3;1H |
| InChIKey | PXOCWFZQRYDVMD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |