C16H26N2O2 — CID 82011195
5-amino-N,4-dimethyl-N-[2-(3-methylphenoxy)ethyl]pentanamide (PubChem CID 82011195) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 5-amino-N,4-dimethyl-N-[2-(3-methylphenoxy)ethyl]pentanamide.
| Compound Name | 5-amino-N,4-dimethyl-N-[2-(3-methylphenoxy)ethyl]pentanamide |
|---|---|
| PubChem CID | 82011195 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 5-amino-N,4-dimethyl-N-[2-(3-methylphenoxy)ethyl]pentanamide |
| SMILES | Cc1cccc(OCCN(C)C(=O)CCC(C)CN)c1 |
| InChI | InChI=1S/C16H26N2O2/c1-13-5-4-6-15(11-13)20-10-9-18(3)16(19)8-7-14(2)12-17/h4-6,11,14H,7-10,12,17H2,1-3H3 |
| InChIKey | OEJZCNPUJCVWEE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |