C15H23ClN2O2 — CID 82011724
5-amino-N-[2-(3-chlorophenoxy)ethyl]-N,4-dimethylpentanamide (PubChem CID 82011724) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is 5-amino-N-[2-(3-chlorophenoxy)ethyl]-N,4-dimethylpentanamide.
| Compound Name | 5-amino-N-[2-(3-chlorophenoxy)ethyl]-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 82011724 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 5-amino-N-[2-(3-chlorophenoxy)ethyl]-N,4-dimethylpentanamide |
| SMILES | CC(CN)CCC(=O)N(C)CCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H23ClN2O2/c1-12(11-17)6-7-15(19)18(2)8-9-20-14-5-3-4-13(16)10-14/h3-5,10,12H,6-9,11,17H2,1-2H3 |
| InChIKey | DUXZIBJONSEOMI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |