C14H21ClN2O2 — CID 81075390
4-amino-N-[2-(4-chlorophenoxy)ethyl]-N,3-dimethylbutanamide (PubChem CID 81075390) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 4-amino-N-[2-(4-chlorophenoxy)ethyl]-N,3-dimethylbutanamide.
| Compound Name | 4-amino-N-[2-(4-chlorophenoxy)ethyl]-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 81075390 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 4-amino-N-[2-(4-chlorophenoxy)ethyl]-N,3-dimethylbutanamide |
| SMILES | CC(CN)CC(=O)N(C)CCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H21ClN2O2/c1-11(10-16)9-14(18)17(2)7-8-19-13-5-3-12(15)4-6-13/h3-6,11H,7-10,16H2,1-2H3 |
| InChIKey | OSZZBKRDCSUDKZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |