C15H23ClN2O2 — CID 103929089
(2R)-2-amino-N-[2-(4-chlorophenoxy)ethyl]-N,3,3-trimethylbutanamide (PubChem CID 103929089) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-(4-chlorophenoxy)ethyl]-N,3,3-trimethylbutanamide.
| Compound Name | (2R)-2-amino-N-[2-(4-chlorophenoxy)ethyl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 103929089 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (2R)-2-amino-N-[2-(4-chlorophenoxy)ethyl]-N,3,3-trimethylbutanamide |
| SMILES | CN(CCOc1ccc(Cl)cc1)C(=O)[C@H](N)C(C)(C)C |
| InChI | InChI=1S/C15H23ClN2O2/c1-15(2,3)13(17)14(19)18(4)9-10-20-12-7-5-11(16)6-8-12/h5-8,13H,9-10,17H2,1-4H3/t13-/m0/s1 |
| InChIKey | BDTOXKUDLJVOGI-ZDUSSCGKSA-N |
| XLogP | 2.55 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |