C12H17FN2O2 — CID 54995498
(2R)-2-amino-N-[2-(4-fluorophenoxy)ethyl]-N-methylpropanamide (PubChem CID 54995498) has the molecular formula C12H17FN2O2 and a molecular weight of 240.28 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-(4-fluorophenoxy)ethyl]-N-methylpropanamide.
| Compound Name | (2R)-2-amino-N-[2-(4-fluorophenoxy)ethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 54995498 |
| Molecular Formula | C12H17FN2O2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (2R)-2-amino-N-[2-(4-fluorophenoxy)ethyl]-N-methylpropanamide |
| SMILES | C[C@@H](N)C(=O)N(C)CCOc1ccc(F)cc1 |
| InChI | InChI=1S/C12H17FN2O2/c1-9(14)12(16)15(2)7-8-17-11-5-3-10(13)4-6-11/h3-6,9H,7-8,14H2,1-2H3/t9-/m1/s1 |
| InChIKey | QFXAUCTYTVZZNG-SECBINFHSA-N |
| XLogP | 1.01 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |