C14H21FN2O4S — CID 119956183
2-amino-N-[2-(4-fluorophenoxy)ethyl]-N-methyl-4-methylsulfonylbutanamide (PubChem CID 119956183) has the molecular formula C14H21FN2O4S and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-amino-N-[2-(4-fluorophenoxy)ethyl]-N-methyl-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-[2-(4-fluorophenoxy)ethyl]-N-methyl-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 119956183 |
| Molecular Formula | C14H21FN2O4S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-amino-N-[2-(4-fluorophenoxy)ethyl]-N-methyl-4-methylsulfonylbutanamide |
| SMILES | CN(CCOc1ccc(F)cc1)C(=O)C(N)CCS(C)(=O)=O |
| InChI | InChI=1S/C14H21FN2O4S/c1-17(14(18)13(16)7-10-22(2,19)20)8-9-21-12-5-3-11(15)4-6-12/h3-6,13H,7-10,16H2,1-2H3 |
| InChIKey | WRKSYAYNDZXZNR-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |