C14H18ClN5O2 — CID 131936026
N-[2-(3-chlorophenoxy)ethyl]-N-methyl-3-(5-methyltetrazol-1-yl)propanamide (PubChem CID 131936026) has the molecular formula C14H18ClN5O2 and a molecular weight of 323.78 g/mol. Its IUPAC name is N-[2-(3-chlorophenoxy)ethyl]-N-methyl-3-(5-methyltetrazol-1-yl)propanamide.
| Compound Name | N-[2-(3-chlorophenoxy)ethyl]-N-methyl-3-(5-methyltetrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 131936026 |
| Molecular Formula | C14H18ClN5O2 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-[2-(3-chlorophenoxy)ethyl]-N-methyl-3-(5-methyltetrazol-1-yl)propanamide |
| SMILES | Cc1nnnn1CCC(=O)N(C)CCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H18ClN5O2/c1-11-16-17-18-20(11)7-6-14(21)19(2)8-9-22-13-5-3-4-12(15)10-13/h3-5,10H,6-9H2,1-2H3 |
| InChIKey | UJPALMVLQWOBHW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |