C15H23N5O5S — CID 120805841
4-[[3-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-3-oxopropyl]amino]-3-nitrobenzenesulfonamide (PubChem CID 120805841) has the molecular formula C15H23N5O5S and a molecular weight of 385.45 g/mol. Its IUPAC name is 4-[[3-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-3-oxopropyl]amino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[3-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-3-oxopropyl]amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 120805841 |
| Molecular Formula | C15H23N5O5S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 4-[[3-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-3-oxopropyl]amino]-3-nitrobenzenesulfonamide |
| SMILES | CC1(CN)CCN(C(=O)CCNc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H23N5O5S/c1-15(9-16)5-7-19(10-15)14(21)4-6-18-12-3-2-11(26(17,24)25)8-13(12)20(22)23/h2-3,8,18H,4-7,9-10,16H2,1H3,(H2,17,24,25) |
| InChIKey | GTEHOUXMDZWOQO-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 161.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|