C15H21Cl2N3O4 — CID 120809856
1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-3-(4-chloro-2-nitrophenoxy)propan-1-one;hydrochloride (PubChem CID 120809856) has the molecular formula C15H21Cl2N3O4 and a molecular weight of 378.26 g/mol. Its IUPAC name is 1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-3-(4-chloro-2-nitrophenoxy)propan-1-one;hydrochloride.
| Compound Name | 1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-3-(4-chloro-2-nitrophenoxy)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120809856 |
| Molecular Formula | C15H21Cl2N3O4 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-3-(4-chloro-2-nitrophenoxy)propan-1-one;hydrochloride |
| SMILES | CC1(CN)CCN(C(=O)CCOc2ccc(Cl)cc2[N+](=O)[O-])C1.Cl |
| InChI | InChI=1S/C15H20ClN3O4.ClH/c1-15(9-17)5-6-18(10-15)14(20)4-7-23-13-3-2-11(16)8-12(13)19(21)22;/h2-3,8H,4-7,9-10,17H2,1H3;1H |
| InChIKey | HEDYAAKIZMDMHG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|