C20H25N5O5S — CID 37322815
3-(2-nitro-4-sulfamoylanilino)-N-(2-piperidin-1-ylphenyl)propanamide (PubChem CID 37322815) has the molecular formula C20H25N5O5S and a molecular weight of 447.52 g/mol. Its IUPAC name is 3-(2-nitro-4-sulfamoylanilino)-N-(2-piperidin-1-ylphenyl)propanamide.
| Compound Name | 3-(2-nitro-4-sulfamoylanilino)-N-(2-piperidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 37322815 |
| Molecular Formula | C20H25N5O5S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 3-(2-nitro-4-sulfamoylanilino)-N-(2-piperidin-1-ylphenyl)propanamide |
| SMILES | NS(=O)(=O)c1ccc(NCCC(=O)Nc2ccccc2N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H25N5O5S/c21-31(29,30)15-8-9-16(19(14-15)25(27)28)22-11-10-20(26)23-17-6-2-3-7-18(17)24-12-4-1-5-13-24/h2-3,6-9,14,22H,1,4-5,10-13H2,(H,23,26)(H2,21,29,30) |
| InChIKey | MDXALKLNMUDWHJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 147.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|