C22H22N4O6S — CID 24503032
N-[4-(4-methylphenoxy)phenyl]-3-(2-nitro-4-sulfamoylanilino)propanamide (PubChem CID 24503032) has the molecular formula C22H22N4O6S and a molecular weight of 470.51 g/mol. Its IUPAC name is N-[4-(4-methylphenoxy)phenyl]-3-(2-nitro-4-sulfamoylanilino)propanamide.
| Compound Name | N-[4-(4-methylphenoxy)phenyl]-3-(2-nitro-4-sulfamoylanilino)propanamide |
|---|---|
| PubChem CID | 24503032 |
| Molecular Formula | C22H22N4O6S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | N-[4-(4-methylphenoxy)phenyl]-3-(2-nitro-4-sulfamoylanilino)propanamide |
| SMILES | Cc1ccc(Oc2ccc(NC(=O)CCNc3ccc(S(N)(=O)=O)cc3[N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C22H22N4O6S/c1-15-2-6-17(7-3-15)32-18-8-4-16(5-9-18)25-22(27)12-13-24-20-11-10-19(33(23,30)31)14-21(20)26(28)29/h2-11,14,24H,12-13H2,1H3,(H,25,27)(H2,23,30,31) |
| InChIKey | JEWXNFUSWHBUHC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|