C18H24N6O5S — CID 55964508
N-[6-(diethylamino)-3-pyridinyl]-3-(2-nitro-4-sulfamoylanilino)propanamide (PubChem CID 55964508) has the molecular formula C18H24N6O5S and a molecular weight of 436.49 g/mol. Its IUPAC name is N-[6-(diethylamino)-3-pyridinyl]-3-(2-nitro-4-sulfamoylanilino)propanamide.
| Compound Name | N-[6-(diethylamino)-3-pyridinyl]-3-(2-nitro-4-sulfamoylanilino)propanamide |
|---|---|
| PubChem CID | 55964508 |
| Molecular Formula | C18H24N6O5S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-[6-(diethylamino)-3-pyridinyl]-3-(2-nitro-4-sulfamoylanilino)propanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CCNc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])cn1 |
| InChI | InChI=1S/C18H24N6O5S/c1-3-23(4-2)17-8-5-13(12-21-17)22-18(25)9-10-20-15-7-6-14(30(19,28)29)11-16(15)24(26)27/h5-8,11-12,20H,3-4,9-10H2,1-2H3,(H,22,25)(H2,19,28,29) |
| InChIKey | ZHZFRCOAPQEJDC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 160.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|