C18H17FN6O5S — CID 55993883
N-(3-fluoro-4-pyrazol-1-ylphenyl)-3-(2-nitro-4-sulfamoylanilino)propanamide (PubChem CID 55993883) has the molecular formula C18H17FN6O5S and a molecular weight of 448.44 g/mol. Its IUPAC name is N-(3-fluoro-4-pyrazol-1-ylphenyl)-3-(2-nitro-4-sulfamoylanilino)propanamide.
| Compound Name | N-(3-fluoro-4-pyrazol-1-ylphenyl)-3-(2-nitro-4-sulfamoylanilino)propanamide |
|---|---|
| PubChem CID | 55993883 |
| Molecular Formula | C18H17FN6O5S |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N-(3-fluoro-4-pyrazol-1-ylphenyl)-3-(2-nitro-4-sulfamoylanilino)propanamide |
| SMILES | NS(=O)(=O)c1ccc(NCCC(=O)Nc2ccc(-n3cccn3)c(F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17FN6O5S/c19-14-10-12(2-5-16(14)24-9-1-7-22-24)23-18(26)6-8-21-15-4-3-13(31(20,29)30)11-17(15)25(27)28/h1-5,7,9-11,21H,6,8H2,(H,23,26)(H2,20,29,30) |
| InChIKey | FADKTPZTGNBRDM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 162.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|