C16H15F3N4O5S — CID 24502548
3-(2-nitro-4-sulfamoylanilino)-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 24502548) has the molecular formula C16H15F3N4O5S and a molecular weight of 432.38 g/mol. Its IUPAC name is 3-(2-nitro-4-sulfamoylanilino)-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(2-nitro-4-sulfamoylanilino)-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 24502548 |
| Molecular Formula | C16H15F3N4O5S |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 3-(2-nitro-4-sulfamoylanilino)-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | NS(=O)(=O)c1ccc(NCCC(=O)Nc2cccc(C(F)(F)F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H15F3N4O5S/c17-16(18,19)10-2-1-3-11(8-10)22-15(24)6-7-21-13-5-4-12(29(20,27)28)9-14(13)23(25)26/h1-5,8-9,21H,6-7H2,(H,22,24)(H2,20,27,28) |
| InChIKey | CKZCEAUWFPTPCX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|