C17H16F3N3O4 — CID 9092335
N-[3-(hydroxymethyl)phenyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide (PubChem CID 9092335) has the molecular formula C17H16F3N3O4 and a molecular weight of 383.33 g/mol. Its IUPAC name is N-[3-(hydroxymethyl)phenyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-[3-(hydroxymethyl)phenyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 9092335 |
| Molecular Formula | C17H16F3N3O4 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N-[3-(hydroxymethyl)phenyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
| SMILES | O=C(CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])Nc1cccc(CO)c1 |
| InChI | InChI=1S/C17H16F3N3O4/c18-17(19,20)12-4-5-14(15(9-12)23(26)27)21-7-6-16(25)22-13-3-1-2-11(8-13)10-24/h1-5,8-9,21,24H,6-7,10H2,(H,22,25) |
| InChIKey | PCURFKGCBRHVLZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|