C22H19F3N4O5 — CID 55505726
N-[4-[[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]methyl]phenyl]furan-2-carboxamide (PubChem CID 55505726) has the molecular formula C22H19F3N4O5 and a molecular weight of 476.41 g/mol. Its IUPAC name is N-[4-[[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55505726 |
| Molecular Formula | C22H19F3N4O5 |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | N-[4-[[3-[2-nitro-4-(trifluoromethyl)anilino]propanoylamino]methyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])NCc1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C22H19F3N4O5/c23-22(24,25)15-5-8-17(18(12-15)29(32)33)26-10-9-20(30)27-13-14-3-6-16(7-4-14)28-21(31)19-2-1-11-34-19/h1-8,11-12,26H,9-10,13H2,(H,27,30)(H,28,31) |
| InChIKey | PMERZNXRADFWEO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|