C23H26F3N5O4 — CID 55708985
N-[[4-(4-methylpiperazine-1-carbonyl)phenyl]methyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide (PubChem CID 55708985) has the molecular formula C23H26F3N5O4 and a molecular weight of 493.49 g/mol. Its IUPAC name is N-[[4-(4-methylpiperazine-1-carbonyl)phenyl]methyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-[[4-(4-methylpiperazine-1-carbonyl)phenyl]methyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 55708985 |
| Molecular Formula | C23H26F3N5O4 |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | N-[[4-(4-methylpiperazine-1-carbonyl)phenyl]methyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
| SMILES | CN1CCN(C(=O)c2ccc(CNC(=O)CCNc3ccc(C(F)(F)F)cc3[N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C23H26F3N5O4/c1-29-10-12-30(13-11-29)22(33)17-4-2-16(3-5-17)15-28-21(32)8-9-27-19-7-6-18(23(24,25)26)14-20(19)31(34)35/h2-7,14,27H,8-13,15H2,1H3,(H,28,32) |
| InChIKey | DXNBXRUHPKHEFE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|