C17H22F3N5O4 — CID 134040705
N-methyl-2-[4-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]piperazin-1-yl]acetamide (PubChem CID 134040705) has the molecular formula C17H22F3N5O4 and a molecular weight of 417.39 g/mol. Its IUPAC name is N-methyl-2-[4-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]piperazin-1-yl]acetamide.
| Compound Name | N-methyl-2-[4-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 134040705 |
| Molecular Formula | C17H22F3N5O4 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | N-methyl-2-[4-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]piperazin-1-yl]acetamide |
| SMILES | CNC(=O)CN1CCN(C(=O)CCNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H22F3N5O4/c1-21-15(26)11-23-6-8-24(9-7-23)16(27)4-5-22-13-3-2-12(17(18,19)20)10-14(13)25(28)29/h2-3,10,22H,4-9,11H2,1H3,(H,21,26) |
| InChIKey | GAKZKOQPTXNNRS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|