C19H26F3N5O4 — CID 46432136
N,N-diethyl-4-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]piperazine-1-carboxamide (PubChem CID 46432136) has the molecular formula C19H26F3N5O4 and a molecular weight of 445.44 g/mol. Its IUPAC name is N,N-diethyl-4-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]piperazine-1-carboxamide.
| Compound Name | N,N-diethyl-4-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 46432136 |
| Molecular Formula | C19H26F3N5O4 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | N,N-diethyl-4-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyl]piperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(C(=O)CCNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H26F3N5O4/c1-3-24(4-2)18(29)26-11-9-25(10-12-26)17(28)7-8-23-15-6-5-14(19(20,21)22)13-16(15)27(30)31/h5-6,13,23H,3-4,7-12H2,1-2H3 |
| InChIKey | OFUMYYYACMJUEQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|