C20H18N4O5 — CID 9278883
N-[4-[2-(2-nitroanilino)ethylcarbamoyl]phenyl]furan-2-carboxamide (PubChem CID 9278883) has the molecular formula C20H18N4O5 and a molecular weight of 394.39 g/mol. Its IUPAC name is N-[4-[2-(2-nitroanilino)ethylcarbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[2-(2-nitroanilino)ethylcarbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 9278883 |
| Molecular Formula | C20H18N4O5 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-[4-[2-(2-nitroanilino)ethylcarbamoyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(NCCNc1ccccc1[N+](=O)[O-])c1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C20H18N4O5/c25-19(22-12-11-21-16-4-1-2-5-17(16)24(27)28)14-7-9-15(10-8-14)23-20(26)18-6-3-13-29-18/h1-10,13,21H,11-12H2,(H,22,25)(H,23,26) |
| InChIKey | OPPOJAPCYBGKTA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|