C22H26F3N5O3 — CID 42304424
N-[4-(4-ethylpiperazin-1-yl)phenyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide (PubChem CID 42304424) has the molecular formula C22H26F3N5O3 and a molecular weight of 465.48 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)phenyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 42304424 |
| Molecular Formula | C22H26F3N5O3 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)CCNc3ccc(C(F)(F)F)cc3[N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C22H26F3N5O3/c1-2-28-11-13-29(14-12-28)18-6-4-17(5-7-18)27-21(31)9-10-26-19-8-3-16(22(23,24)25)15-20(19)30(32)33/h3-8,15,26H,2,9-14H2,1H3,(H,27,31) |
| InChIKey | ZVIMGKRRSYOSAT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|