C18H16F3N7O3 — CID 55564173
N-[3-methyl-4-(tetrazol-1-yl)phenyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide (PubChem CID 55564173) has the molecular formula C18H16F3N7O3 and a molecular weight of 435.37 g/mol. Its IUPAC name is N-[3-methyl-4-(tetrazol-1-yl)phenyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-[3-methyl-4-(tetrazol-1-yl)phenyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 55564173 |
| Molecular Formula | C18H16F3N7O3 |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-[3-methyl-4-(tetrazol-1-yl)phenyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
| SMILES | Cc1cc(NC(=O)CCNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])ccc1-n1cnnn1 |
| InChI | InChI=1S/C18H16F3N7O3/c1-11-8-13(3-5-15(11)27-10-23-25-26-27)24-17(29)6-7-22-14-4-2-12(18(19,20)21)9-16(14)28(30)31/h2-5,8-10,22H,6-7H2,1H3,(H,24,29) |
| InChIKey | RDNRSMDSNAYXGQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|