C15H23N5O5S — CID 119469474
4-[[3-[2-(aminomethyl)piperidin-1-yl]-3-oxopropyl]amino]-3-nitrobenzenesulfonamide (PubChem CID 119469474) has the molecular formula C15H23N5O5S and a molecular weight of 385.45 g/mol. Its IUPAC name is 4-[[3-[2-(aminomethyl)piperidin-1-yl]-3-oxopropyl]amino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[3-[2-(aminomethyl)piperidin-1-yl]-3-oxopropyl]amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 119469474 |
| Molecular Formula | C15H23N5O5S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 4-[[3-[2-(aminomethyl)piperidin-1-yl]-3-oxopropyl]amino]-3-nitrobenzenesulfonamide |
| SMILES | NCC1CCCCN1C(=O)CCNc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H23N5O5S/c16-10-11-3-1-2-8-19(11)15(21)6-7-18-13-5-4-12(26(17,24)25)9-14(13)20(22)23/h4-5,9,11,18H,1-3,6-8,10,16H2,(H2,17,24,25) |
| InChIKey | KVSLJXSRHLXCSM-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 161.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|