C20H17F3N2O8 — CID 55405642
dimethyl 5-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyloxy]benzene-1,3-dicarboxylate (PubChem CID 55405642) has the molecular formula C20H17F3N2O8 and a molecular weight of 470.36 g/mol. Its IUPAC name is dimethyl 5-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyloxy]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyloxy]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 55405642 |
| Molecular Formula | C20H17F3N2O8 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | dimethyl 5-[3-[2-nitro-4-(trifluoromethyl)anilino]propanoyloxy]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OC(=O)CCNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc(C(=O)OC)c1 |
| InChI | InChI=1S/C20H17F3N2O8/c1-31-18(27)11-7-12(19(28)32-2)9-14(8-11)33-17(26)5-6-24-15-4-3-13(20(21,22)23)10-16(15)25(29)30/h3-4,7-10,24H,5-6H2,1-2H3 |
| InChIKey | NKPKEGSDMSSXAX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|