C35H50F3N3O16 — CID 142403238
methyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-(trifluoromethyl)benzoate (PubChem CID 142403238) has the molecular formula C35H50F3N3O16 and a molecular weight of 825.78 g/mol. Its IUPAC name is methyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-(trifluoromethyl)benzoate.
| Compound Name | methyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 142403238 |
| Molecular Formula | C35H50F3N3O16 |
| Molecular Weight | 825.78 g/mol |
| Exact Mass | 825.31 |
| IUPAC Name | methyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1cc(OCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C35H50F3N3O16/c1-47-34(42)28-24-29(35(36,37)38)26-31(25-28)57-23-22-56-21-20-55-19-18-54-17-16-53-15-14-52-13-12-51-11-10-50-9-8-49-7-6-48-5-4-39-32-3-2-30(40(43)44)27-33(32)41(45)46/h2-3,24-27,39H,4-23H2,1H3 |
| InChIKey | POUZTCAFCQDNTA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 216.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.78 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|