C35H50FN3O16 — CID 142403229
(E)-3-[3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-fluorophenyl]prop-2-enoic acid (PubChem CID 142403229) has the molecular formula C35H50FN3O16 and a molecular weight of 787.79 g/mol. Its IUPAC name is (E)-3-[3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 142403229 |
| Molecular Formula | C35H50FN3O16 |
| Molecular Weight | 787.79 g/mol |
| Exact Mass | 787.32 |
| IUPAC Name | (E)-3-[3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-fluorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(F)cc(OCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C35H50FN3O16/c36-30-25-29(1-4-35(40)41)26-32(27-30)55-24-23-54-22-21-53-20-19-52-18-17-51-16-15-50-14-13-49-12-11-48-10-9-47-8-7-46-6-5-37-33-3-2-31(38(42)43)28-34(33)39(44)45/h1-4,25-28,37H,5-24H2,(H,40,41)/b4-1+ |
| InChIKey | JWWKZTUYEHXTSJ-DAFODLJHSA-N |
| XLogP | 3.38 |
| TPSA | 227.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.79 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|