C35H48N6O15 — CID 142403287
4-[2-[2-[2-[2-[[4-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethylamino]-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-1H-indole-2-carboxylic acid (PubChem CID 142403287) has the molecular formula C35H48N6O15 and a molecular weight of 792.80 g/mol. Its IUPAC name is 4-[2-[2-[2-[2-[[4-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethylamino]-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-1H-indole-2-carboxylic acid.
| Compound Name | 4-[2-[2-[2-[2-[[4-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethylamino]-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 142403287 |
| Molecular Formula | C35H48N6O15 |
| Molecular Weight | 792.80 g/mol |
| Exact Mass | 792.32 |
| IUPAC Name | 4-[2-[2-[2-[2-[[4-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethylamino]-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-1H-indole-2-carboxylic acid |
| SMILES | O=C(CCC(=O)NCCOCCOCCOCCOc1cccc2[nH]c(C(=O)O)cc12)NCCOCCOCCOCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C35H48N6O15/c42-33(37-9-12-51-15-18-53-17-14-50-11-8-36-29-5-4-26(40(46)47)24-31(29)41(48)49)6-7-34(43)38-10-13-52-16-19-54-20-21-55-22-23-56-32-3-1-2-28-27(32)25-30(39-28)35(44)45/h1-5,24-25,36,39H,6-23H2,(H,37,42)(H,38,43)(H,44,45) |
| InChIKey | UBKFKSNBPOMWKP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 274.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.80 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|